C14H16FN3O — CID 137412574
1-[(5R,6S)-5-cyclohexa-2,4-dien-1-yl-6-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]propan-1-one (PubChem CID 137412574) has the molecular formula C14H16FN3O and a molecular weight of 261.30 g/mol. Its IUPAC name is 1-[(5R,6S)-5-cyclohexa-2,4-dien-1-yl-6-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]propan-1-one.
| Compound Name | 1-[(5R,6S)-5-cyclohexa-2,4-dien-1-yl-6-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]propan-1-one |
|---|---|
| PubChem CID | 137412574 |
| Molecular Formula | C14H16FN3O |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 1-[(5R,6S)-5-cyclohexa-2,4-dien-1-yl-6-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]propan-1-one |
| SMILES | CCC(=O)c1nc2n(n1)[C@H](C1C=CC=CC1)[C@@H](F)C2 |
| InChI | InChI=1S/C14H16FN3O/c1-2-11(19)14-16-12-8-10(15)13(18(12)17-14)9-6-4-3-5-7-9/h3-6,9-10,13H,2,7-8H2,1H3/t9?,10-,13+/m0/s1 |
| InChIKey | ATKNQNBONRJSDY-QQIFVLEESA-N |
| XLogP | 2.44 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |