C14H15F2N3O — CID 137412585
[(5S,7S)-7-fluoro-5-(3-fluorobuta-1,3-dien-2-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-[(1S,2S)-2-methylcyclopropyl]methanone (PubChem CID 137412585) has the molecular formula C14H15F2N3O and a molecular weight of 279.29 g/mol. Its IUPAC name is [(5S,7S)-7-fluoro-5-(3-fluorobuta-1,3-dien-2-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-[(1S,2S)-2-methylcyclopropyl]methanone.
| Compound Name | [(5S,7S)-7-fluoro-5-(3-fluorobuta-1,3-dien-2-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-[(1S,2S)-2-methylcyclopropyl]methanone |
|---|---|
| PubChem CID | 137412585 |
| Molecular Formula | C14H15F2N3O |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | [(5S,7S)-7-fluoro-5-(3-fluorobuta-1,3-dien-2-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-[(1S,2S)-2-methylcyclopropyl]methanone |
| SMILES | C=C(F)C(=C)[C@@H]1C[C@H](F)c2nc(C(=O)[C@H]3C[C@@H]3C)nn21 |
| InChI | InChI=1S/C14H15F2N3O/c1-6-4-9(6)12(20)13-17-14-10(16)5-11(19(14)18-13)7(2)8(3)15/h6,9-11H,2-5H2,1H3/t6-,9-,10-,11-/m0/s1 |
| InChIKey | PMDVPYBHERODFT-JGBZZBSPSA-N |
| XLogP | 3.11 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|