C13H14FN3O — CID 137412609
[(5R,7S)-5-buta-1,3-dien-2-yl-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-cyclopropylmethanone (PubChem CID 137412609) has the molecular formula C13H14FN3O and a molecular weight of 247.27 g/mol. Its IUPAC name is [(5R,7S)-5-buta-1,3-dien-2-yl-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-cyclopropylmethanone.
| Compound Name | [(5R,7S)-5-buta-1,3-dien-2-yl-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 137412609 |
| Molecular Formula | C13H14FN3O |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | [(5R,7S)-5-buta-1,3-dien-2-yl-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-cyclopropylmethanone |
| SMILES | C=CC(=C)[C@H]1C[C@H](F)c2nc(C(=O)C3CC3)nn21 |
| InChI | InChI=1S/C13H14FN3O/c1-3-7(2)10-6-9(14)13-15-12(16-17(10)13)11(18)8-4-5-8/h3,8-10H,1-2,4-6H2/t9-,10+/m0/s1 |
| InChIKey | SQFIWCLHEBDDNG-VHSXEESVSA-N |
| XLogP | 2.57 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|