About 8-benzyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid
8-benzyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (PubChem CID 137412863) has the molecular formula C18H12F8O3S
and a molecular weight of 460.34 g/mol. Its IUPAC name is 8-benzyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
Molecular Properties
| Compound Name | 8-benzyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| PubChem CID | 137412863 |
| Molecular Formula | C18H12F8O3S |
| Molecular Weight | 460.34 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | 8-benzyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid |
| SMILES | O=C(O)C1=Cc2cc(S(F)(F)(F)(F)F)cc(Cc3ccccc3)c2OC1C(F)(F)F |
| InChI | InChI=1S/C18H12F8O3S/c19-18(20,21)16-14(17(27)28)9-12-8-13(30(22,23,24,25)26)7-11(15(12)29-16)6-10-4-2-1-3-5-10/h1-5,7-9,16H,6H2,(H,27,28) |
| InChIKey | YLPACHDKURHZGI-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.34 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-benzyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-benzyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid?
The IUPAC name of 8-benzyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid (CID 137412863) is 8-benzyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid.
What is the SMILES notation for 8-benzyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid?
The canonical SMILES for 8-benzyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid is O=C(O)C1=Cc2cc(S(F)(F)(F)(F)F)cc(Cc3ccccc3)c2OC1C(F)(F)F.
What is the InChIKey of 8-benzyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid?
The InChIKey is YLPACHDKURHZGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12F8O3S/c19-18(20,21)16-14(17(27)28)9-12-8-13(30(22,23,24,25)26)7-11(15(12)29-16)6-10-4-2-1-3-5-10/h1-5,7-9,16H,6H2,(H,27,28).
What are the key properties of 8-benzyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid?
8-benzyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid has a molecular weight of 460.34 g/mol, XLogP of 6.73, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-benzyl-6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylic acid is sourced from PubChem (CID 137412863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).