C15H21N — CID 137413139
(2Z,4Z)-8-cyclobutyl-4-propa-1,2-dienylocta-2,4-dien-1-imine (PubChem CID 137413139) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is (2Z,4Z)-8-cyclobutyl-4-propa-1,2-dienylocta-2,4-dien-1-imine.
| Compound Name | (2Z,4Z)-8-cyclobutyl-4-propa-1,2-dienylocta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 137413139 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | (2Z,4Z)-8-cyclobutyl-4-propa-1,2-dienylocta-2,4-dien-1-imine |
| SMILES | [H]/N=C\C=C/C(C=C=C)=C/CCCC1CCC1 |
| InChI | InChI=1S/C15H21N/c1-2-7-14(12-6-13-16)8-3-4-9-15-10-5-11-15/h6-8,12-13,15-16H,1,3-5,9-11H2/b12-6-,14-8+,16-13- |
| InChIKey | AFMPNBUGOYITPZ-DBVKJXSGSA-N |
| XLogP | 4.43 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|