C22H20N4O2S — CID 1374139
1-(2,3-dihydroindol-1-yl)-2-[[5-(2,3-dimethyl-1H-indol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethanone (PubChem CID 1374139) has the molecular formula C22H20N4O2S and a molecular weight of 404.50 g/mol. Its IUPAC name is 1-(2,3-dihydroindol-1-yl)-2-[[5-(2,3-dimethyl-1H-indol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethanone.
| Compound Name | 1-(2,3-dihydroindol-1-yl)-2-[[5-(2,3-dimethyl-1H-indol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 1374139 |
| Molecular Formula | C22H20N4O2S |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 1-(2,3-dihydroindol-1-yl)-2-[[5-(2,3-dimethyl-1H-indol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethanone |
| SMILES | Cc1[nH]c2ccc(-c3nnc(SCC(=O)N4CCc5ccccc54)o3)cc2c1C |
| InChI | InChI=1S/C22H20N4O2S/c1-13-14(2)23-18-8-7-16(11-17(13)18)21-24-25-22(28-21)29-12-20(27)26-10-9-15-5-3-4-6-19(15)26/h3-8,11,23H,9-10,12H2,1-2H3 |
| InChIKey | GFHPKNUWIFKXCW-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|