C19H24N2O — CID 137413998
11-[4-(methylamino)butyl]-10-azatricyclo[6.5.2.09,13]pentadeca-1(14),2,4,6,8(15)-pentaen-12-one (PubChem CID 137413998) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is 11-[4-(methylamino)butyl]-10-azatricyclo[6.5.2.09,13]pentadeca-1(14),2,4,6,8(15)-pentaen-12-one.
| Compound Name | 11-[4-(methylamino)butyl]-10-azatricyclo[6.5.2.09,13]pentadeca-1(14),2,4,6,8(15)-pentaen-12-one |
|---|---|
| PubChem CID | 137413998 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 11-[4-(methylamino)butyl]-10-azatricyclo[6.5.2.09,13]pentadeca-1(14),2,4,6,8(15)-pentaen-12-one |
| SMILES | CNCCCCC1NC2C3=CC=C(/C=C\C=C\C=C/3)C2C1=O |
| InChI | InChI=1S/C19H24N2O/c1-20-13-7-6-10-16-19(22)17-14-8-4-2-3-5-9-15(12-11-14)18(17)21-16/h2-5,8-9,11-12,16-18,20-21H,6-7,10,13H2,1H3/b3-2+,4-2-,5-3+,8-4-,9-5-,14-8+,15-9+ |
| InChIKey | PKKKSQBFSIFSNN-WIEOBDCHSA-N |
| XLogP | 2.45 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|