C33H39F4N5O5 — CID 137414009
(2,3,5,6-tetrafluorophenyl) 3-[2-[3-[4-(4-amino-2-butyl-6-methylimidazo[4,5-c]quinolin-1-yl)butylamino]-3-oxopropoxy]ethoxy]propanoate (PubChem CID 137414009) has the molecular formula C33H39F4N5O5 and a molecular weight of 661.70 g/mol. Its IUPAC name is (2,3,5,6-tetrafluorophenyl) 3-[2-[3-[4-(4-amino-2-butyl-6-methylimidazo[4,5-c]quinolin-1-yl)butylamino]-3-oxopropoxy]ethoxy]propanoate.
| Compound Name | (2,3,5,6-tetrafluorophenyl) 3-[2-[3-[4-(4-amino-2-butyl-6-methylimidazo[4,5-c]quinolin-1-yl)butylamino]-3-oxopropoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 137414009 |
| Molecular Formula | C33H39F4N5O5 |
| Molecular Weight | 661.70 g/mol |
| Exact Mass | 661.29 |
| IUPAC Name | (2,3,5,6-tetrafluorophenyl) 3-[2-[3-[4-(4-amino-2-butyl-6-methylimidazo[4,5-c]quinolin-1-yl)butylamino]-3-oxopropoxy]ethoxy]propanoate |
| SMILES | CCCCc1nc2c(N)nc3c(C)cccc3c2n1CCCCNC(=O)CCOCCOCCC(=O)Oc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C33H39F4N5O5/c1-3-4-10-24-40-30-31(21-9-7-8-20(2)29(21)41-33(30)38)42(24)14-6-5-13-39-25(43)11-15-45-17-18-46-16-12-26(44)47-32-27(36)22(34)19-23(35)28(32)37/h7-9,19H,3-6,10-18H2,1-2H3,(H2,38,41)(H,39,43) |
| InChIKey | OBUHLDBOUNBMDO-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 130.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.70 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|