C39H47F5N6O6 — CID 137414071
(2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[[4-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butylcarbamoyl]cyclohexanecarbonyl]amino]ethoxy]ethoxy]propanoate (PubChem CID 137414071) has the molecular formula C39H47F5N6O6 and a molecular weight of 790.83 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[[4-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butylcarbamoyl]cyclohexanecarbonyl]amino]ethoxy]ethoxy]propanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[[4-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butylcarbamoyl]cyclohexanecarbonyl]amino]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 137414071 |
| Molecular Formula | C39H47F5N6O6 |
| Molecular Weight | 790.83 g/mol |
| Exact Mass | 790.35 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[[4-[4-(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)butylcarbamoyl]cyclohexanecarbonyl]amino]ethoxy]ethoxy]propanoate |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1CCCCNC(=O)C1CCC(C(=O)NCCOCCOCCC(=O)Oc2c(F)c(F)c(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C39H47F5N6O6/c1-2-3-10-27-49-34-35(25-8-4-5-9-26(25)48-37(34)45)50(27)18-7-6-16-46-38(52)23-11-13-24(14-12-23)39(53)47-17-20-55-22-21-54-19-15-28(51)56-36-32(43)30(41)29(40)31(42)33(36)44/h4-5,8-9,23-24H,2-3,6-7,10-22H2,1H3,(H2,45,48)(H,46,52)(H,47,53) |
| InChIKey | IOCOFNYWHQGCNF-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 159.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.83 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|