About N'-[1-(7-fluoro-5,6-dihydro-1H-indol-3-yl)ethenyl]-N-hexylpentane-1,5-diamine
N'-[1-(7-fluoro-5,6-dihydro-1H-indol-3-yl)ethenyl]-N-hexylpentane-1,5-diamine (PubChem CID 137414307) has the molecular formula C21H34FN3
and a molecular weight of 347.52 g/mol. Its IUPAC name is N'-[1-(7-fluoro-5,6-dihydro-1H-indol-3-yl)ethenyl]-N-hexylpentane-1,5-diamine.
Molecular Properties
| Compound Name | N'-[1-(7-fluoro-5,6-dihydro-1H-indol-3-yl)ethenyl]-N-hexylpentane-1,5-diamine |
| PubChem CID | 137414307 |
| Molecular Formula | C21H34FN3 |
| Molecular Weight | 347.52 g/mol |
| Exact Mass | 347.27 |
| IUPAC Name | N'-[1-(7-fluoro-5,6-dihydro-1H-indol-3-yl)ethenyl]-N-hexylpentane-1,5-diamine |
| SMILES | C=C(NCCCCCNCCCCCC)c1c[nH]c2c1=CCCC=2F |
| InChI | InChI=1S/C21H34FN3/c1-3-4-5-7-13-23-14-8-6-9-15-24-17(2)19-16-25-21-18(19)11-10-12-20(21)22/h11,16,23-25H,2-10,12-15H2,1H3 |
| InChIKey | PPHBJWNEKMJVDX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.52 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-[1-(7-fluoro-5,6-dihydro-1H-indol-3-yl)ethenyl]-N-hexylpentane-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[1-(7-fluoro-5,6-dihydro-1H-indol-3-yl)ethenyl]-N-hexylpentane-1,5-diamine?
The IUPAC name of N'-[1-(7-fluoro-5,6-dihydro-1H-indol-3-yl)ethenyl]-N-hexylpentane-1,5-diamine (CID 137414307) is N'-[1-(7-fluoro-5,6-dihydro-1H-indol-3-yl)ethenyl]-N-hexylpentane-1,5-diamine.
What is the SMILES notation for N'-[1-(7-fluoro-5,6-dihydro-1H-indol-3-yl)ethenyl]-N-hexylpentane-1,5-diamine?
The canonical SMILES for N'-[1-(7-fluoro-5,6-dihydro-1H-indol-3-yl)ethenyl]-N-hexylpentane-1,5-diamine is C=C(NCCCCCNCCCCCC)c1c[nH]c2c1=CCCC=2F.
What is the InChIKey of N'-[1-(7-fluoro-5,6-dihydro-1H-indol-3-yl)ethenyl]-N-hexylpentane-1,5-diamine?
The InChIKey is PPHBJWNEKMJVDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H34FN3/c1-3-4-5-7-13-23-14-8-6-9-15-24-17(2)19-16-25-21-18(19)11-10-12-20(21)22/h11,16,23-25H,2-10,12-15H2,1H3.
What are the key properties of N'-[1-(7-fluoro-5,6-dihydro-1H-indol-3-yl)ethenyl]-N-hexylpentane-1,5-diamine?
N'-[1-(7-fluoro-5,6-dihydro-1H-indol-3-yl)ethenyl]-N-hexylpentane-1,5-diamine has a molecular weight of 347.52 g/mol, XLogP of 3.57, 13 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[1-(7-fluoro-5,6-dihydro-1H-indol-3-yl)ethenyl]-N-hexylpentane-1,5-diamine is sourced from PubChem (CID 137414307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).