C14H22N2 — CID 137414437
5-[3-(ethenylamino)prop-1-en-2-yl]-N,4,6-trimethylcyclohexa-1,3-dien-1-amine (PubChem CID 137414437) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 5-[3-(ethenylamino)prop-1-en-2-yl]-N,4,6-trimethylcyclohexa-1,3-dien-1-amine.
| Compound Name | 5-[3-(ethenylamino)prop-1-en-2-yl]-N,4,6-trimethylcyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 137414437 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 5-[3-(ethenylamino)prop-1-en-2-yl]-N,4,6-trimethylcyclohexa-1,3-dien-1-amine |
| SMILES | C=CNCC(=C)C1C(C)=CC=C(NC)C1C |
| InChI | InChI=1S/C14H22N2/c1-6-16-9-11(3)14-10(2)7-8-13(15-5)12(14)4/h6-8,12,14-16H,1,3,9H2,2,4-5H3 |
| InChIKey | MLQWLNBABSMZDM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|