C20H17N3O3S — CID 1374155
4-[[5-(2,3-dimethyl-1H-indol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]benzoic acid (PubChem CID 1374155) has the molecular formula C20H17N3O3S and a molecular weight of 379.44 g/mol. Its IUPAC name is 4-[[5-(2,3-dimethyl-1H-indol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]benzoic acid.
| Compound Name | 4-[[5-(2,3-dimethyl-1H-indol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]benzoic acid |
|---|---|
| PubChem CID | 1374155 |
| Molecular Formula | C20H17N3O3S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 4-[[5-(2,3-dimethyl-1H-indol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]benzoic acid |
| SMILES | Cc1[nH]c2ccc(-c3nnc(SCc4ccc(C(=O)O)cc4)o3)cc2c1C |
| InChI | InChI=1S/C20H17N3O3S/c1-11-12(2)21-17-8-7-15(9-16(11)17)18-22-23-20(26-18)27-10-13-3-5-14(6-4-13)19(24)25/h3-9,21H,10H2,1-2H3,(H,24,25) |
| InChIKey | CSUCZUOJKQEAST-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 92.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|