C21H20ClF2N5O2 — CID 137415754
5-chloro-2-[[(3,5-difluoro-2-pyridinyl)methylamino]methyl]spiro[6,8-dihydro-[1,3]oxazolo[5,4-f]quinazoline-9,1'-cyclohexane]-7-one (PubChem CID 137415754) has the molecular formula C21H20ClF2N5O2 and a molecular weight of 447.87 g/mol. Its IUPAC name is 5-chloro-2-[[(3,5-difluoro-2-pyridinyl)methylamino]methyl]spiro[6,8-dihydro-[1,3]oxazolo[5,4-f]quinazoline-9,1'-cyclohexane]-7-one.
| Compound Name | 5-chloro-2-[[(3,5-difluoro-2-pyridinyl)methylamino]methyl]spiro[6,8-dihydro-[1,3]oxazolo[5,4-f]quinazoline-9,1'-cyclohexane]-7-one |
|---|---|
| PubChem CID | 137415754 |
| Molecular Formula | C21H20ClF2N5O2 |
| Molecular Weight | 447.87 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 5-chloro-2-[[(3,5-difluoro-2-pyridinyl)methylamino]methyl]spiro[6,8-dihydro-[1,3]oxazolo[5,4-f]quinazoline-9,1'-cyclohexane]-7-one |
| SMILES | O=C1Nc2c(Cl)cc3nc(CNCc4ncc(F)cc4F)oc3c2C2(CCCCC2)N1 |
| InChI | InChI=1S/C21H20ClF2N5O2/c22-12-7-14-19(17-18(12)28-20(30)29-21(17)4-2-1-3-5-21)31-16(27-14)10-25-9-15-13(24)6-11(23)8-26-15/h6-8,25H,1-5,9-10H2,(H2,28,29,30) |
| InChIKey | UKJDRKNTSZVUAQ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.87 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |