C18H17ClF3N3O3 — CID 137415864
5-chloro-7-oxo-N-(2,2,2-trifluoroethyl)spiro[6,8-dihydrofuro[2,3-f]quinazoline-9,1'-cyclohexane]-2-carboxamide (PubChem CID 137415864) has the molecular formula C18H17ClF3N3O3 and a molecular weight of 415.80 g/mol. Its IUPAC name is 5-chloro-7-oxo-N-(2,2,2-trifluoroethyl)spiro[6,8-dihydrofuro[2,3-f]quinazoline-9,1'-cyclohexane]-2-carboxamide.
| Compound Name | 5-chloro-7-oxo-N-(2,2,2-trifluoroethyl)spiro[6,8-dihydrofuro[2,3-f]quinazoline-9,1'-cyclohexane]-2-carboxamide |
|---|---|
| PubChem CID | 137415864 |
| Molecular Formula | C18H17ClF3N3O3 |
| Molecular Weight | 415.80 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 5-chloro-7-oxo-N-(2,2,2-trifluoroethyl)spiro[6,8-dihydrofuro[2,3-f]quinazoline-9,1'-cyclohexane]-2-carboxamide |
| SMILES | O=C1Nc2c(Cl)cc3cc(C(=O)NCC(F)(F)F)oc3c2C2(CCCCC2)N1 |
| InChI | InChI=1S/C18H17ClF3N3O3/c19-10-6-9-7-11(15(26)23-8-18(20,21)22)28-14(9)12-13(10)24-16(27)25-17(12)4-2-1-3-5-17/h6-7H,1-5,8H2,(H,23,26)(H2,24,25,27) |
| InChIKey | ZUGIXAKYENMZNH-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.80 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |