C22H27ClN6O2 — CID 137415921
5-chloro-2-[[(4-ethyl-1,2,4-triazol-3-yl)methyl-methylamino]methyl]spiro[6,8-dihydrofuro[2,3-f]quinazoline-9,1'-cyclohexane]-7-one (PubChem CID 137415921) has the molecular formula C22H27ClN6O2 and a molecular weight of 442.95 g/mol. Its IUPAC name is 5-chloro-2-[[(4-ethyl-1,2,4-triazol-3-yl)methyl-methylamino]methyl]spiro[6,8-dihydrofuro[2,3-f]quinazoline-9,1'-cyclohexane]-7-one.
| Compound Name | 5-chloro-2-[[(4-ethyl-1,2,4-triazol-3-yl)methyl-methylamino]methyl]spiro[6,8-dihydrofuro[2,3-f]quinazoline-9,1'-cyclohexane]-7-one |
|---|---|
| PubChem CID | 137415921 |
| Molecular Formula | C22H27ClN6O2 |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 5-chloro-2-[[(4-ethyl-1,2,4-triazol-3-yl)methyl-methylamino]methyl]spiro[6,8-dihydrofuro[2,3-f]quinazoline-9,1'-cyclohexane]-7-one |
| SMILES | CCn1cnnc1CN(C)Cc1cc2cc(Cl)c3c(c2o1)C1(CCCCC1)NC(=O)N3 |
| InChI | InChI=1S/C22H27ClN6O2/c1-3-29-13-24-27-17(29)12-28(2)11-15-9-14-10-16(23)19-18(20(14)31-15)22(26-21(30)25-19)7-5-4-6-8-22/h9-10,13H,3-8,11-12H2,1-2H3,(H2,25,26,30) |
| InChIKey | REZXIFZMELDZGL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 88.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |