C17H18ClF3N4O2 — CID 137415935
5-chloro-2-[(2,2,2-trifluoroethylamino)methyl]spiro[6,8-dihydro-[1,3]oxazolo[5,4-f]quinazoline-9,1'-cyclohexane]-7-one (PubChem CID 137415935) has the molecular formula C17H18ClF3N4O2 and a molecular weight of 402.80 g/mol. Its IUPAC name is 5-chloro-2-[(2,2,2-trifluoroethylamino)methyl]spiro[6,8-dihydro-[1,3]oxazolo[5,4-f]quinazoline-9,1'-cyclohexane]-7-one.
| Compound Name | 5-chloro-2-[(2,2,2-trifluoroethylamino)methyl]spiro[6,8-dihydro-[1,3]oxazolo[5,4-f]quinazoline-9,1'-cyclohexane]-7-one |
|---|---|
| PubChem CID | 137415935 |
| Molecular Formula | C17H18ClF3N4O2 |
| Molecular Weight | 402.80 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 5-chloro-2-[(2,2,2-trifluoroethylamino)methyl]spiro[6,8-dihydro-[1,3]oxazolo[5,4-f]quinazoline-9,1'-cyclohexane]-7-one |
| SMILES | O=C1Nc2c(Cl)cc3nc(CNCC(F)(F)F)oc3c2C2(CCCCC2)N1 |
| InChI | InChI=1S/C17H18ClF3N4O2/c18-9-6-10-14(27-11(23-10)7-22-8-17(19,20)21)12-13(9)24-15(26)25-16(12)4-2-1-3-5-16/h6,22H,1-5,7-8H2,(H2,24,25,26) |
| InChIKey | GQMNBSMLPDTZHE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.80 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |