C18H21ClF2N4O3 — CID 137415954
5-chloro-2-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]spiro[6,8-dihydro-[1,3]oxazolo[5,4-f]quinazoline-9,1'-cyclohexane]-7-one (PubChem CID 137415954) has the molecular formula C18H21ClF2N4O3 and a molecular weight of 414.84 g/mol. Its IUPAC name is 5-chloro-2-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]spiro[6,8-dihydro-[1,3]oxazolo[5,4-f]quinazoline-9,1'-cyclohexane]-7-one.
| Compound Name | 5-chloro-2-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]spiro[6,8-dihydro-[1,3]oxazolo[5,4-f]quinazoline-9,1'-cyclohexane]-7-one |
|---|---|
| PubChem CID | 137415954 |
| Molecular Formula | C18H21ClF2N4O3 |
| Molecular Weight | 414.84 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 5-chloro-2-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]spiro[6,8-dihydro-[1,3]oxazolo[5,4-f]quinazoline-9,1'-cyclohexane]-7-one |
| SMILES | O=C1Nc2c(Cl)cc3nc(CNCC(F)(F)CO)oc3c2C2(CCCCC2)N1 |
| InChI | InChI=1S/C18H21ClF2N4O3/c19-10-6-11-15(28-12(23-11)7-22-8-18(20,21)9-26)13-14(10)24-16(27)25-17(13)4-2-1-3-5-17/h6,22,26H,1-5,7-9H2,(H2,24,25,27) |
| InChIKey | NRBUQVASCARKOK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.84 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |