C23H21ClF3N5O3 — CID 137415978
5-chloro-2-[2-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-7-carbonyl]spiro[6,8-dihydrofuro[2,3-f]quinazoline-9,1'-cyclohexane]-7-one (PubChem CID 137415978) has the molecular formula C23H21ClF3N5O3 and a molecular weight of 507.90 g/mol. Its IUPAC name is 5-chloro-2-[2-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-7-carbonyl]spiro[6,8-dihydrofuro[2,3-f]quinazoline-9,1'-cyclohexane]-7-one.
| Compound Name | 5-chloro-2-[2-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-7-carbonyl]spiro[6,8-dihydrofuro[2,3-f]quinazoline-9,1'-cyclohexane]-7-one |
|---|---|
| PubChem CID | 137415978 |
| Molecular Formula | C23H21ClF3N5O3 |
| Molecular Weight | 507.90 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | 5-chloro-2-[2-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-7-carbonyl]spiro[6,8-dihydrofuro[2,3-f]quinazoline-9,1'-cyclohexane]-7-one |
| SMILES | O=C1Nc2c(Cl)cc3cc(C(=O)N4CCn5cc(C(F)(F)F)nc5C4)oc3c2C2(CCCCC2)N1 |
| InChI | InChI=1S/C23H21ClF3N5O3/c24-13-8-12-9-14(20(33)32-7-6-31-10-15(23(25,26)27)28-16(31)11-32)35-19(12)17-18(13)29-21(34)30-22(17)4-2-1-3-5-22/h8-10H,1-7,11H2,(H2,29,30,34) |
| InChIKey | JYYFAMILGXNTSU-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.90 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |