C22H30ClN5O2 — CID 137416026
5-chloro-2-[(3,3,4-trimethylpiperazin-1-yl)methyl]spiro[6,8-dihydro-[1,3]oxazolo[5,4-f]quinazoline-9,1'-cyclohexane]-7-one (PubChem CID 137416026) has the molecular formula C22H30ClN5O2 and a molecular weight of 431.97 g/mol. Its IUPAC name is 5-chloro-2-[(3,3,4-trimethylpiperazin-1-yl)methyl]spiro[6,8-dihydro-[1,3]oxazolo[5,4-f]quinazoline-9,1'-cyclohexane]-7-one.
| Compound Name | 5-chloro-2-[(3,3,4-trimethylpiperazin-1-yl)methyl]spiro[6,8-dihydro-[1,3]oxazolo[5,4-f]quinazoline-9,1'-cyclohexane]-7-one |
|---|---|
| PubChem CID | 137416026 |
| Molecular Formula | C22H30ClN5O2 |
| Molecular Weight | 431.97 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 5-chloro-2-[(3,3,4-trimethylpiperazin-1-yl)methyl]spiro[6,8-dihydro-[1,3]oxazolo[5,4-f]quinazoline-9,1'-cyclohexane]-7-one |
| SMILES | CN1CCN(Cc2nc3cc(Cl)c4c(c3o2)C2(CCCCC2)NC(=O)N4)CC1(C)C |
| InChI | InChI=1S/C22H30ClN5O2/c1-21(2)13-28(10-9-27(21)3)12-16-24-15-11-14(23)18-17(19(15)30-16)22(26-20(29)25-18)7-5-4-6-8-22/h11H,4-10,12-13H2,1-3H3,(H2,25,26,29) |
| InChIKey | OVBBNIXJCLXVIX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 73.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.97 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |