C23H27ClN4O3 — CID 137416027
2-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]-5-chlorospiro[6,8-dihydrofuro[2,3-f]quinazoline-9,1'-cyclohexane]-7-one (PubChem CID 137416027) has the molecular formula C23H27ClN4O3 and a molecular weight of 442.95 g/mol. Its IUPAC name is 2-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]-5-chlorospiro[6,8-dihydrofuro[2,3-f]quinazoline-9,1'-cyclohexane]-7-one.
| Compound Name | 2-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]-5-chlorospiro[6,8-dihydrofuro[2,3-f]quinazoline-9,1'-cyclohexane]-7-one |
|---|---|
| PubChem CID | 137416027 |
| Molecular Formula | C23H27ClN4O3 |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 2-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carbonyl]-5-chlorospiro[6,8-dihydrofuro[2,3-f]quinazoline-9,1'-cyclohexane]-7-one |
| SMILES | O=C1Nc2c(Cl)cc3cc(C(=O)N4CCN5CCC[C@H]5C4)oc3c2C2(CCCCC2)N1 |
| InChI | InChI=1S/C23H27ClN4O3/c24-16-11-14-12-17(21(29)28-10-9-27-8-4-5-15(27)13-28)31-20(14)18-19(16)25-22(30)26-23(18)6-2-1-3-7-23/h11-12,15H,1-10,13H2,(H2,25,26,30)/t15-/m0/s1 |
| InChIKey | UIBHYOMMKPWYOG-HNNXBMFYSA-N |
| XLogP | 4.30 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |