C20H15FINO — CID 137417021
N-(2,4-dimethylphenyl)-6-fluoro-N-iododibenzofuran-4-amine (PubChem CID 137417021) has the molecular formula C20H15FINO and a molecular weight of 431.25 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-6-fluoro-N-iododibenzofuran-4-amine.
| Compound Name | N-(2,4-dimethylphenyl)-6-fluoro-N-iododibenzofuran-4-amine |
|---|---|
| PubChem CID | 137417021 |
| Molecular Formula | C20H15FINO |
| Molecular Weight | 431.25 g/mol |
| Exact Mass | 431.02 |
| IUPAC Name | N-(2,4-dimethylphenyl)-6-fluoro-N-iododibenzofuran-4-amine |
| SMILES | Cc1ccc(N(I)c2cccc3c2oc2c(F)cccc23)c(C)c1 |
| InChI | InChI=1S/C20H15FINO/c1-12-9-10-17(13(2)11-12)23(22)18-8-4-6-15-14-5-3-7-16(21)19(14)24-20(15)18/h3-11H,1-2H3 |
| InChIKey | FFMLVDZYAVJOIC-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.25 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|