About (3Z)-3-[(E)-2-fluorobut-2-enylidene]-2,2-dimethylfuran
(3Z)-3-[(E)-2-fluorobut-2-enylidene]-2,2-dimethylfuran (PubChem CID 137417276) has the molecular formula C10H13FO
and a molecular weight of 168.21 g/mol. Its IUPAC name is (3Z)-3-[(E)-2-fluorobut-2-enylidene]-2,2-dimethylfuran.
Molecular Properties
| Compound Name | (3Z)-3-[(E)-2-fluorobut-2-enylidene]-2,2-dimethylfuran |
| PubChem CID | 137417276 |
| Molecular Formula | C10H13FO |
| Molecular Weight | 168.21 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | (3Z)-3-[(E)-2-fluorobut-2-enylidene]-2,2-dimethylfuran |
| SMILES | C/C=C(F)\C=C1\C=COC1(C)C |
| InChI | InChI=1S/C10H13FO/c1-4-9(11)7-8-5-6-12-10(8,2)3/h4-7H,1-3H3/b8-7-,9-4+ |
| InChIKey | GJAINPAIGJACSZ-TZRLODCYSA-N |
| XLogP | 3.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.21 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3Z)-3-[(E)-2-fluorobut-2-enylidene]-2,2-dimethylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-[(E)-2-fluorobut-2-enylidene]-2,2-dimethylfuran?
The IUPAC name of (3Z)-3-[(E)-2-fluorobut-2-enylidene]-2,2-dimethylfuran (CID 137417276) is (3Z)-3-[(E)-2-fluorobut-2-enylidene]-2,2-dimethylfuran.
What is the SMILES notation for (3Z)-3-[(E)-2-fluorobut-2-enylidene]-2,2-dimethylfuran?
The canonical SMILES for (3Z)-3-[(E)-2-fluorobut-2-enylidene]-2,2-dimethylfuran is C/C=C(F)\C=C1\C=COC1(C)C.
What is the InChIKey of (3Z)-3-[(E)-2-fluorobut-2-enylidene]-2,2-dimethylfuran?
The InChIKey is GJAINPAIGJACSZ-TZRLODCYSA-N. The full InChI is InChI=1S/C10H13FO/c1-4-9(11)7-8-5-6-12-10(8,2)3/h4-7H,1-3H3/b8-7-,9-4+.
What are the key properties of (3Z)-3-[(E)-2-fluorobut-2-enylidene]-2,2-dimethylfuran?
(3Z)-3-[(E)-2-fluorobut-2-enylidene]-2,2-dimethylfuran has a molecular weight of 168.21 g/mol, XLogP of 3.11, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-[(E)-2-fluorobut-2-enylidene]-2,2-dimethylfuran is sourced from PubChem (CID 137417276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).