C12H18FN — CID 137417370
(3R,5aR)-7-fluoro-3,5-dimethyl-5a,6,7,8,9,9a-hexahydro-3H-1-benzazepine (PubChem CID 137417370) has the molecular formula C12H18FN and a molecular weight of 195.28 g/mol. Its IUPAC name is (3R,5aR)-7-fluoro-3,5-dimethyl-5a,6,7,8,9,9a-hexahydro-3H-1-benzazepine.
| Compound Name | (3R,5aR)-7-fluoro-3,5-dimethyl-5a,6,7,8,9,9a-hexahydro-3H-1-benzazepine |
|---|---|
| PubChem CID | 137417370 |
| Molecular Formula | C12H18FN |
| Molecular Weight | 195.28 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | (3R,5aR)-7-fluoro-3,5-dimethyl-5a,6,7,8,9,9a-hexahydro-3H-1-benzazepine |
| SMILES | CC1=C[C@@H](C)C=NC2CCC(F)C[C@H]12 |
| InChI | InChI=1S/C12H18FN/c1-8-5-9(2)11-6-10(13)3-4-12(11)14-7-8/h5,7-8,10-12H,3-4,6H2,1-2H3/t8-,10?,11-,12?/m1/s1 |
| InChIKey | XCTYNMPERSCQNR-AKZNXDQDSA-N |
| XLogP | 3.16 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.28 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|