C10H11N — CID 137417383
(4aR)-2-methyl-3,4,4a,5-tetrahydroquinoline (PubChem CID 137417383) has the molecular formula C10H11N and a molecular weight of 145.20 g/mol. Its IUPAC name is (4aR)-2-methyl-3,4,4a,5-tetrahydroquinoline.
| Compound Name | (4aR)-2-methyl-3,4,4a,5-tetrahydroquinoline |
|---|---|
| PubChem CID | 137417383 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | (4aR)-2-methyl-3,4,4a,5-tetrahydroquinoline |
| SMILES | CC1=NC2=C=C=CC[C@H]2CC1 |
| InChI | InChI=1S/C10H11N/c1-8-6-7-9-4-2-3-5-10(9)11-8/h2,9H,4,6-7H2,1H3/t9-/m0/s1 |
| InChIKey | SLVFARSLOZGBIA-VIFPVBQESA-N |
| XLogP | 2.46 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |