C11H18FN — CID 137417390
(6S)-6-fluoro-1,2-dimethyl-4a,5,6,7,8,8a-hexahydro-2H-quinoline (PubChem CID 137417390) has the molecular formula C11H18FN and a molecular weight of 183.27 g/mol. Its IUPAC name is (6S)-6-fluoro-1,2-dimethyl-4a,5,6,7,8,8a-hexahydro-2H-quinoline.
| Compound Name | (6S)-6-fluoro-1,2-dimethyl-4a,5,6,7,8,8a-hexahydro-2H-quinoline |
|---|---|
| PubChem CID | 137417390 |
| Molecular Formula | C11H18FN |
| Molecular Weight | 183.27 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | (6S)-6-fluoro-1,2-dimethyl-4a,5,6,7,8,8a-hexahydro-2H-quinoline |
| SMILES | CC1C=CC2C[C@@H](F)CCC2N1C |
| InChI | InChI=1S/C11H18FN/c1-8-3-4-9-7-10(12)5-6-11(9)13(8)2/h3-4,8-11H,5-7H2,1-2H3/t8?,9?,10-,11?/m0/s1 |
| InChIKey | UXKVGBNQFMKARR-MWJCJQSMSA-N |
| XLogP | 2.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|