C9H10BrN3 — CID 137417396
1-(3-bromo-3-methylcyclohexa-1,5-dien-1-yl)-1,2,4-triazole (PubChem CID 137417396) has the molecular formula C9H10BrN3 and a molecular weight of 240.10 g/mol. Its IUPAC name is 1-(3-bromo-3-methylcyclohexa-1,5-dien-1-yl)-1,2,4-triazole.
| Compound Name | 1-(3-bromo-3-methylcyclohexa-1,5-dien-1-yl)-1,2,4-triazole |
|---|---|
| PubChem CID | 137417396 |
| Molecular Formula | C9H10BrN3 |
| Molecular Weight | 240.10 g/mol |
| Exact Mass | 239.01 |
| IUPAC Name | 1-(3-bromo-3-methylcyclohexa-1,5-dien-1-yl)-1,2,4-triazole |
| SMILES | CC1(Br)C=C(n2cncn2)C=CC1 |
| InChI | InChI=1S/C9H10BrN3/c1-9(10)4-2-3-8(5-9)13-7-11-6-12-13/h2-3,5-7H,4H2,1H3 |
| InChIKey | FPJMZQJOBPZRFB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.10 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|