About 5-fluoro-2-methyl-2,3,5,6-tetrahydro-1-benzofuran
5-fluoro-2-methyl-2,3,5,6-tetrahydro-1-benzofuran (PubChem CID 137417397) has the molecular formula C9H11FO
and a molecular weight of 154.18 g/mol. Its IUPAC name is 5-fluoro-2-methyl-2,3,5,6-tetrahydro-1-benzofuran.
Analyze 5-fluoro-2-methyl-2,3,5,6-tetrahydro-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-methyl-2,3,5,6-tetrahydro-1-benzofuran?
The IUPAC name of 5-fluoro-2-methyl-2,3,5,6-tetrahydro-1-benzofuran (CID 137417397) is 5-fluoro-2-methyl-2,3,5,6-tetrahydro-1-benzofuran.
What is the SMILES notation for 5-fluoro-2-methyl-2,3,5,6-tetrahydro-1-benzofuran?
The canonical SMILES for 5-fluoro-2-methyl-2,3,5,6-tetrahydro-1-benzofuran is CC1CC2=CC(F)CC=C2O1.
What is the InChIKey of 5-fluoro-2-methyl-2,3,5,6-tetrahydro-1-benzofuran?
The InChIKey is ZDVVMUIAHRBYHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FO/c1-6-4-7-5-8(10)2-3-9(7)11-6/h3,5-6,8H,2,4H2,1H3.
What are the key properties of 5-fluoro-2-methyl-2,3,5,6-tetrahydro-1-benzofuran?
5-fluoro-2-methyl-2,3,5,6-tetrahydro-1-benzofuran has a molecular weight of 154.18 g/mol, XLogP of 2.35, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-methyl-2,3,5,6-tetrahydro-1-benzofuran is sourced from PubChem (CID 137417397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).