About spiro[cyclopentane-1,9'-fluorene]-4'-amine
spiro[cyclopentane-1,9'-fluorene]-4'-amine (PubChem CID 137417428) has the molecular formula C17H17N
and a molecular weight of 235.33 g/mol. Its IUPAC name is spiro[cyclopentane-1,9'-fluorene]-4'-amine.
Molecular Properties
| Compound Name | spiro[cyclopentane-1,9'-fluorene]-4'-amine |
| PubChem CID | 137417428 |
| Molecular Formula | C17H17N |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | spiro[cyclopentane-1,9'-fluorene]-4'-amine |
| SMILES | Nc1cccc2c1-c1ccccc1C21CCCC1 |
| InChI | InChI=1S/C17H17N/c18-15-9-5-8-14-16(15)12-6-1-2-7-13(12)17(14)10-3-4-11-17/h1-2,5-9H,3-4,10-11,18H2 |
| InChIKey | CTSTUGLDAHWHPL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze spiro[cyclopentane-1,9'-fluorene]-4'-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[cyclopentane-1,9'-fluorene]-4'-amine?
The IUPAC name of spiro[cyclopentane-1,9'-fluorene]-4'-amine (CID 137417428) is spiro[cyclopentane-1,9'-fluorene]-4'-amine.
What is the SMILES notation for spiro[cyclopentane-1,9'-fluorene]-4'-amine?
The canonical SMILES for spiro[cyclopentane-1,9'-fluorene]-4'-amine is Nc1cccc2c1-c1ccccc1C21CCCC1.
What is the InChIKey of spiro[cyclopentane-1,9'-fluorene]-4'-amine?
The InChIKey is CTSTUGLDAHWHPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N/c18-15-9-5-8-14-16(15)12-6-1-2-7-13(12)17(14)10-3-4-11-17/h1-2,5-9H,3-4,10-11,18H2.
What are the key properties of spiro[cyclopentane-1,9'-fluorene]-4'-amine?
spiro[cyclopentane-1,9'-fluorene]-4'-amine has a molecular weight of 235.33 g/mol, XLogP of 4.11, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[cyclopentane-1,9'-fluorene]-4'-amine is sourced from PubChem (CID 137417428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).