About (2Z,4E)-1-fluoro-6-methyl-4-prop-2-enoxyhepta-2,4-diene
(2Z,4E)-1-fluoro-6-methyl-4-prop-2-enoxyhepta-2,4-diene (PubChem CID 137417452) has the molecular formula C11H17FO
and a molecular weight of 184.25 g/mol. Its IUPAC name is (2Z,4E)-1-fluoro-6-methyl-4-prop-2-enoxyhepta-2,4-diene.
Molecular Properties
| Compound Name | (2Z,4E)-1-fluoro-6-methyl-4-prop-2-enoxyhepta-2,4-diene |
| PubChem CID | 137417452 |
| Molecular Formula | C11H17FO |
| Molecular Weight | 184.25 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | (2Z,4E)-1-fluoro-6-methyl-4-prop-2-enoxyhepta-2,4-diene |
| SMILES | C=CCOC(/C=C\CF)=C/C(C)C |
| InChI | InChI=1S/C11H17FO/c1-4-8-13-11(6-5-7-12)9-10(2)3/h4-6,9-10H,1,7-8H2,2-3H3/b6-5-,11-9+ |
| InChIKey | BHKZZFDKLMWIHB-QEYVUMQQSA-N |
| XLogP | 3.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.25 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4E)-1-fluoro-6-methyl-4-prop-2-enoxyhepta-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4E)-1-fluoro-6-methyl-4-prop-2-enoxyhepta-2,4-diene?
The IUPAC name of (2Z,4E)-1-fluoro-6-methyl-4-prop-2-enoxyhepta-2,4-diene (CID 137417452) is (2Z,4E)-1-fluoro-6-methyl-4-prop-2-enoxyhepta-2,4-diene.
What is the SMILES notation for (2Z,4E)-1-fluoro-6-methyl-4-prop-2-enoxyhepta-2,4-diene?
The canonical SMILES for (2Z,4E)-1-fluoro-6-methyl-4-prop-2-enoxyhepta-2,4-diene is C=CCOC(/C=C\CF)=C/C(C)C.
What is the InChIKey of (2Z,4E)-1-fluoro-6-methyl-4-prop-2-enoxyhepta-2,4-diene?
The InChIKey is BHKZZFDKLMWIHB-QEYVUMQQSA-N. The full InChI is InChI=1S/C11H17FO/c1-4-8-13-11(6-5-7-12)9-10(2)3/h4-6,9-10H,1,7-8H2,2-3H3/b6-5-,11-9+.
What are the key properties of (2Z,4E)-1-fluoro-6-methyl-4-prop-2-enoxyhepta-2,4-diene?
(2Z,4E)-1-fluoro-6-methyl-4-prop-2-enoxyhepta-2,4-diene has a molecular weight of 184.25 g/mol, XLogP of 3.25, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4E)-1-fluoro-6-methyl-4-prop-2-enoxyhepta-2,4-diene is sourced from PubChem (CID 137417452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).