C14H20N2 — CID 137417463
1-[(8aS)-1,2,8,8a-tetrahydronaphthalen-2-yl]piperazine (PubChem CID 137417463) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 1-[(8aS)-1,2,8,8a-tetrahydronaphthalen-2-yl]piperazine.
| Compound Name | 1-[(8aS)-1,2,8,8a-tetrahydronaphthalen-2-yl]piperazine |
|---|---|
| PubChem CID | 137417463 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 1-[(8aS)-1,2,8,8a-tetrahydronaphthalen-2-yl]piperazine |
| SMILES | C1=CC[C@H]2CC(N3CCNCC3)C=CC2=C1 |
| InChI | InChI=1S/C14H20N2/c1-2-4-13-11-14(6-5-12(13)3-1)16-9-7-15-8-10-16/h1-3,5-6,13-15H,4,7-11H2/t13-,14?/m0/s1 |
| InChIKey | LCJPATRRRAHRTA-LSLKUGRBSA-N |
| XLogP | 1.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |