About N-[2-[(4,6-dimethylquinolin-2-yl)-ethylamino]ethyl]-2-hydroxyacetamide
N-[2-[(4,6-dimethylquinolin-2-yl)-ethylamino]ethyl]-2-hydroxyacetamide (PubChem CID 137417499) has the molecular formula C17H23N3O2
and a molecular weight of 301.39 g/mol. Its IUPAC name is N-[2-[(4,6-dimethylquinolin-2-yl)-ethylamino]ethyl]-2-hydroxyacetamide.
Molecular Properties
| Compound Name | N-[2-[(4,6-dimethylquinolin-2-yl)-ethylamino]ethyl]-2-hydroxyacetamide |
| PubChem CID | 137417499 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | N-[2-[(4,6-dimethylquinolin-2-yl)-ethylamino]ethyl]-2-hydroxyacetamide |
| SMILES | CCN(CCNC(=O)CO)c1cc(C)c2cc(C)ccc2n1 |
| InChI | InChI=1S/C17H23N3O2/c1-4-20(8-7-18-17(22)11-21)16-10-13(3)14-9-12(2)5-6-15(14)19-16/h5-6,9-10,21H,4,7-8,11H2,1-3H3,(H,18,22) |
| InChIKey | OCJUPQKWCUVHPE-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-[(4,6-dimethylquinolin-2-yl)-ethylamino]ethyl]-2-hydroxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(4,6-dimethylquinolin-2-yl)-ethylamino]ethyl]-2-hydroxyacetamide?
The IUPAC name of N-[2-[(4,6-dimethylquinolin-2-yl)-ethylamino]ethyl]-2-hydroxyacetamide (CID 137417499) is N-[2-[(4,6-dimethylquinolin-2-yl)-ethylamino]ethyl]-2-hydroxyacetamide.
What is the SMILES notation for N-[2-[(4,6-dimethylquinolin-2-yl)-ethylamino]ethyl]-2-hydroxyacetamide?
The canonical SMILES for N-[2-[(4,6-dimethylquinolin-2-yl)-ethylamino]ethyl]-2-hydroxyacetamide is CCN(CCNC(=O)CO)c1cc(C)c2cc(C)ccc2n1.
What is the InChIKey of N-[2-[(4,6-dimethylquinolin-2-yl)-ethylamino]ethyl]-2-hydroxyacetamide?
The InChIKey is OCJUPQKWCUVHPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3O2/c1-4-20(8-7-18-17(22)11-21)16-10-13(3)14-9-12(2)5-6-15(14)19-16/h5-6,9-10,21H,4,7-8,11H2,1-3H3,(H,18,22).
What are the key properties of N-[2-[(4,6-dimethylquinolin-2-yl)-ethylamino]ethyl]-2-hydroxyacetamide?
N-[2-[(4,6-dimethylquinolin-2-yl)-ethylamino]ethyl]-2-hydroxyacetamide has a molecular weight of 301.39 g/mol, XLogP of 1.79, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(4,6-dimethylquinolin-2-yl)-ethylamino]ethyl]-2-hydroxyacetamide is sourced from PubChem (CID 137417499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).