C12H14FN — CID 137417507
6-fluoro-2,4,5-trimethyl-4a,5-dihydroquinoline (PubChem CID 137417507) has the molecular formula C12H14FN and a molecular weight of 191.25 g/mol. Its IUPAC name is 6-fluoro-2,4,5-trimethyl-4a,5-dihydroquinoline.
| Compound Name | 6-fluoro-2,4,5-trimethyl-4a,5-dihydroquinoline |
|---|---|
| PubChem CID | 137417507 |
| Molecular Formula | C12H14FN |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 6-fluoro-2,4,5-trimethyl-4a,5-dihydroquinoline |
| SMILES | CC1=CC(C)=NC2=CC=C(F)C(C)C12 |
| InChI | InChI=1S/C12H14FN/c1-7-6-8(2)14-11-5-4-10(13)9(3)12(7)11/h4-6,9,12H,1-3H3 |
| InChIKey | HNZBDPBSSRQACO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |