About cis-(1R,2S)-2-[[2-amino-7-(1H-pyrazol-5-yl)quinolin-4-yl]amino]cyclohexan-1-ol
cis-(1R,2S)-2-[[2-amino-7-(1H-pyrazol-5-yl)quinolin-4-yl]amino]cyclohexan-1-ol (PubChem CID 137417575) has the molecular formula C18H21N5O
and a molecular weight of 323.40 g/mol. Its IUPAC name is cis-(1R,2S)-2-[[2-amino-7-(1H-pyrazol-5-yl)quinolin-4-yl]amino]cyclohexan-1-ol.
Molecular Properties
| Compound Name | cis-(1R,2S)-2-[[2-amino-7-(1H-pyrazol-5-yl)quinolin-4-yl]amino]cyclohexan-1-ol |
| PubChem CID | 137417575 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | cis-(1R,2S)-2-[[2-amino-7-(1H-pyrazol-5-yl)quinolin-4-yl]amino]cyclohexan-1-ol |
| SMILES | Nc1cc(N[C@H]2CCCC[C@H]2O)c2ccc(-c3ccn[nH]3)cc2n1 |
| InChI | InChI=1S/C18H21N5O/c19-18-10-16(21-14-3-1-2-4-17(14)24)12-6-5-11(9-15(12)22-18)13-7-8-20-23-13/h5-10,14,17,24H,1-4H2,(H,20,23)(H3,19,21,22)/t14-,17+/m0/s1 |
| InChIKey | MNEOGTMXUXIRCQ-WMLDXEAASA-N |
| XLogP | 2.92 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cis-(1R,2S)-2-[[2-amino-7-(1H-pyrazol-5-yl)quinolin-4-yl]amino]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,2S)-2-[[2-amino-7-(1H-pyrazol-5-yl)quinolin-4-yl]amino]cyclohexan-1-ol?
The IUPAC name of cis-(1R,2S)-2-[[2-amino-7-(1H-pyrazol-5-yl)quinolin-4-yl]amino]cyclohexan-1-ol (CID 137417575) is cis-(1R,2S)-2-[[2-amino-7-(1H-pyrazol-5-yl)quinolin-4-yl]amino]cyclohexan-1-ol.
What is the SMILES notation for cis-(1R,2S)-2-[[2-amino-7-(1H-pyrazol-5-yl)quinolin-4-yl]amino]cyclohexan-1-ol?
The canonical SMILES for cis-(1R,2S)-2-[[2-amino-7-(1H-pyrazol-5-yl)quinolin-4-yl]amino]cyclohexan-1-ol is Nc1cc(N[C@H]2CCCC[C@H]2O)c2ccc(-c3ccn[nH]3)cc2n1.
What is the InChIKey of cis-(1R,2S)-2-[[2-amino-7-(1H-pyrazol-5-yl)quinolin-4-yl]amino]cyclohexan-1-ol?
The InChIKey is MNEOGTMXUXIRCQ-WMLDXEAASA-N. The full InChI is InChI=1S/C18H21N5O/c19-18-10-16(21-14-3-1-2-4-17(14)24)12-6-5-11(9-15(12)22-18)13-7-8-20-23-13/h5-10,14,17,24H,1-4H2,(H,20,23)(H3,19,21,22)/t14-,17+/m0/s1.
What are the key properties of cis-(1R,2S)-2-[[2-amino-7-(1H-pyrazol-5-yl)quinolin-4-yl]amino]cyclohexan-1-ol?
cis-(1R,2S)-2-[[2-amino-7-(1H-pyrazol-5-yl)quinolin-4-yl]amino]cyclohexan-1-ol has a molecular weight of 323.40 g/mol, XLogP of 2.92, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2S)-2-[[2-amino-7-(1H-pyrazol-5-yl)quinolin-4-yl]amino]cyclohexan-1-ol is sourced from PubChem (CID 137417575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).