C16H14N6O — CID 137417842
4-N-(1,3-oxazol-5-ylmethyl)-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine (PubChem CID 137417842) has the molecular formula C16H14N6O and a molecular weight of 306.33 g/mol. Its IUPAC name is 4-N-(1,3-oxazol-5-ylmethyl)-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine.
| Compound Name | 4-N-(1,3-oxazol-5-ylmethyl)-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine |
|---|---|
| PubChem CID | 137417842 |
| Molecular Formula | C16H14N6O |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 4-N-(1,3-oxazol-5-ylmethyl)-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine |
| SMILES | Nc1cc(NCc2cnco2)c2ccc(-c3ccn[nH]3)cc2n1 |
| InChI | InChI=1S/C16H14N6O/c17-16-6-14(19-8-11-7-18-9-23-11)12-2-1-10(5-15(12)21-16)13-3-4-20-22-13/h1-7,9H,8H2,(H,20,22)(H3,17,19,21) |
| InChIKey | ZARFUXRWYCJEGG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 105.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |