C18H21N5O — CID 137417892
3-[(oxolan-2-ylmethylamino)methyl]-7-(1H-pyrazol-5-yl)quinolin-2-amine (PubChem CID 137417892) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is 3-[(oxolan-2-ylmethylamino)methyl]-7-(1H-pyrazol-5-yl)quinolin-2-amine.
| Compound Name | 3-[(oxolan-2-ylmethylamino)methyl]-7-(1H-pyrazol-5-yl)quinolin-2-amine |
|---|---|
| PubChem CID | 137417892 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 3-[(oxolan-2-ylmethylamino)methyl]-7-(1H-pyrazol-5-yl)quinolin-2-amine |
| SMILES | Nc1nc2cc(-c3ccn[nH]3)ccc2cc1CNCC1CCCO1 |
| InChI | InChI=1S/C18H21N5O/c19-18-14(10-20-11-15-2-1-7-24-15)8-12-3-4-13(9-17(12)22-18)16-5-6-21-23-16/h3-6,8-9,15,20H,1-2,7,10-11H2,(H2,19,22)(H,21,23) |
| InChIKey | WHMVBYSMJYXXSH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |