About 4-N-[(2-methylpyrazol-3-yl)methyl]-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine
4-N-[(2-methylpyrazol-3-yl)methyl]-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine (PubChem CID 137417910) has the molecular formula C17H17N7
and a molecular weight of 319.37 g/mol. Its IUPAC name is 4-N-[(2-methylpyrazol-3-yl)methyl]-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine.
Molecular Properties
| Compound Name | 4-N-[(2-methylpyrazol-3-yl)methyl]-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine |
| PubChem CID | 137417910 |
| Molecular Formula | C17H17N7 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 4-N-[(2-methylpyrazol-3-yl)methyl]-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine |
| SMILES | Cn1nccc1CNc1cc(N)nc2cc(-c3ccn[nH]3)ccc12 |
| InChI | InChI=1S/C17H17N7/c1-24-12(4-7-21-24)10-19-15-9-17(18)22-16-8-11(2-3-13(15)16)14-5-6-20-23-14/h2-9H,10H2,1H3,(H,20,23)(H3,18,19,22) |
| InChIKey | LWEPTVIVXNYTCK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 97.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-N-[(2-methylpyrazol-3-yl)methyl]-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-[(2-methylpyrazol-3-yl)methyl]-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine?
The IUPAC name of 4-N-[(2-methylpyrazol-3-yl)methyl]-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine (CID 137417910) is 4-N-[(2-methylpyrazol-3-yl)methyl]-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine.
What is the SMILES notation for 4-N-[(2-methylpyrazol-3-yl)methyl]-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine?
The canonical SMILES for 4-N-[(2-methylpyrazol-3-yl)methyl]-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine is Cn1nccc1CNc1cc(N)nc2cc(-c3ccn[nH]3)ccc12.
What is the InChIKey of 4-N-[(2-methylpyrazol-3-yl)methyl]-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine?
The InChIKey is LWEPTVIVXNYTCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N7/c1-24-12(4-7-21-24)10-19-15-9-17(18)22-16-8-11(2-3-13(15)16)14-5-6-20-23-14/h2-9H,10H2,1H3,(H,20,23)(H3,18,19,22).
What are the key properties of 4-N-[(2-methylpyrazol-3-yl)methyl]-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine?
4-N-[(2-methylpyrazol-3-yl)methyl]-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine has a molecular weight of 319.37 g/mol, XLogP of 2.55, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-[(2-methylpyrazol-3-yl)methyl]-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine is sourced from PubChem (CID 137417910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).