C8H10N2O3S2 — CID 137418047
(5Z)-N-hydroxy-6-methylidene-5-methylsulfanyliminocyclohexa-1,3-diene-1-sulfonamide (PubChem CID 137418047) has the molecular formula C8H10N2O3S2 and a molecular weight of 246.31 g/mol. Its IUPAC name is (5Z)-N-hydroxy-6-methylidene-5-methylsulfanyliminocyclohexa-1,3-diene-1-sulfonamide.
| Compound Name | (5Z)-N-hydroxy-6-methylidene-5-methylsulfanyliminocyclohexa-1,3-diene-1-sulfonamide |
|---|---|
| PubChem CID | 137418047 |
| Molecular Formula | C8H10N2O3S2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.01 |
| IUPAC Name | (5Z)-N-hydroxy-6-methylidene-5-methylsulfanyliminocyclohexa-1,3-diene-1-sulfonamide |
| SMILES | C=C1C(S(=O)(=O)NO)=CC=C/C1=N/SC |
| InChI | InChI=1S/C8H10N2O3S2/c1-6-7(9-14-2)4-3-5-8(6)15(12,13)10-11/h3-5,10-11H,1H2,2H3/b9-7- |
| InChIKey | FXUORDNTTZTDOD-CLFYSBASSA-N |
| XLogP | 1.02 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|