C17H22ClFN6O3 — CID 137418241
14-chloro-5-(3-fluorooxan-4-yl)-10-methoxy-4-methyl-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaene (PubChem CID 137418241) has the molecular formula C17H22ClFN6O3 and a molecular weight of 412.85 g/mol. Its IUPAC name is 14-chloro-5-(3-fluorooxan-4-yl)-10-methoxy-4-methyl-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaene.
| Compound Name | 14-chloro-5-(3-fluorooxan-4-yl)-10-methoxy-4-methyl-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaene |
|---|---|
| PubChem CID | 137418241 |
| Molecular Formula | C17H22ClFN6O3 |
| Molecular Weight | 412.85 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 14-chloro-5-(3-fluorooxan-4-yl)-10-methoxy-4-methyl-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaene |
| SMILES | COC1CNc2nc(ncc2Cl)Nc2c(nn(C3CCOCC3F)c2C)OC1 |
| InChI | InChI=1S/C17H22ClFN6O3/c1-9-14-16(24-25(9)13-3-4-27-8-12(13)19)28-7-10(26-2)5-20-15-11(18)6-21-17(22-14)23-15/h6,10,12-13H,3-5,7-8H2,1-2H3,(H2,20,21,22,23) |
| InChIKey | QXECUESOKSFNDM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 95.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.85 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |