C17H21ClF2N6O2 — CID 137418249
14-chloro-11-(difluoromethyl)-4-methyl-5-(oxan-4-yl)-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaene (PubChem CID 137418249) has the molecular formula C17H21ClF2N6O2 and a molecular weight of 414.84 g/mol. Its IUPAC name is 14-chloro-11-(difluoromethyl)-4-methyl-5-(oxan-4-yl)-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaene.
| Compound Name | 14-chloro-11-(difluoromethyl)-4-methyl-5-(oxan-4-yl)-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaene |
|---|---|
| PubChem CID | 137418249 |
| Molecular Formula | C17H21ClF2N6O2 |
| Molecular Weight | 414.84 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 14-chloro-11-(difluoromethyl)-4-methyl-5-(oxan-4-yl)-8-oxa-2,5,6,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,6,13(17),14-pentaene |
| SMILES | Cc1c2c(nn1C1CCOCC1)OCCC(C(F)F)Nc1nc(ncc1Cl)N2 |
| InChI | InChI=1S/C17H21ClF2N6O2/c1-9-13-16(25-26(9)10-2-5-27-6-3-10)28-7-4-12(14(19)20)22-15-11(18)8-21-17(23-13)24-15/h8,10,12,14H,2-7H2,1H3,(H2,21,22,23,24) |
| InChIKey | OSKGMYACQLSUTG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 86.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.84 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |