About [3-[(2,5-dichloropyrimidin-4-yl)amino]-2-fluoropropyl] methanesulfonate
[3-[(2,5-dichloropyrimidin-4-yl)amino]-2-fluoropropyl] methanesulfonate (PubChem CID 137418290) has the molecular formula C8H10Cl2FN3O3S
and a molecular weight of 318.16 g/mol. Its IUPAC name is [3-[(2,5-dichloropyrimidin-4-yl)amino]-2-fluoropropyl] methanesulfonate.
Molecular Properties
| Compound Name | [3-[(2,5-dichloropyrimidin-4-yl)amino]-2-fluoropropyl] methanesulfonate |
| PubChem CID | 137418290 |
| Molecular Formula | C8H10Cl2FN3O3S |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 316.98 |
| IUPAC Name | [3-[(2,5-dichloropyrimidin-4-yl)amino]-2-fluoropropyl] methanesulfonate |
| SMILES | CS(=O)(=O)OCC(F)CNc1nc(Cl)ncc1Cl |
| InChI | InChI=1S/C8H10Cl2FN3O3S/c1-18(15,16)17-4-5(11)2-12-7-6(9)3-13-8(10)14-7/h3,5H,2,4H2,1H3,(H,12,13,14) |
| InChIKey | BKDSYTZSCQBMSM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [3-[(2,5-dichloropyrimidin-4-yl)amino]-2-fluoropropyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(2,5-dichloropyrimidin-4-yl)amino]-2-fluoropropyl] methanesulfonate?
The IUPAC name of [3-[(2,5-dichloropyrimidin-4-yl)amino]-2-fluoropropyl] methanesulfonate (CID 137418290) is [3-[(2,5-dichloropyrimidin-4-yl)amino]-2-fluoropropyl] methanesulfonate.
What is the SMILES notation for [3-[(2,5-dichloropyrimidin-4-yl)amino]-2-fluoropropyl] methanesulfonate?
The canonical SMILES for [3-[(2,5-dichloropyrimidin-4-yl)amino]-2-fluoropropyl] methanesulfonate is CS(=O)(=O)OCC(F)CNc1nc(Cl)ncc1Cl.
What is the InChIKey of [3-[(2,5-dichloropyrimidin-4-yl)amino]-2-fluoropropyl] methanesulfonate?
The InChIKey is BKDSYTZSCQBMSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10Cl2FN3O3S/c1-18(15,16)17-4-5(11)2-12-7-6(9)3-13-8(10)14-7/h3,5H,2,4H2,1H3,(H,12,13,14).
What are the key properties of [3-[(2,5-dichloropyrimidin-4-yl)amino]-2-fluoropropyl] methanesulfonate?
[3-[(2,5-dichloropyrimidin-4-yl)amino]-2-fluoropropyl] methanesulfonate has a molecular weight of 318.16 g/mol, XLogP of 1.51, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(2,5-dichloropyrimidin-4-yl)amino]-2-fluoropropyl] methanesulfonate is sourced from PubChem (CID 137418290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).