C11H15BrN6O — CID 137418369
(1E)-1-(11-bromo-4-imino-5-oxa-2,9,13,14-tetrazabicyclo[8.3.1]tetradeca-1(13),10(14),11-trien-3-ylidene)ethanamine (PubChem CID 137418369) has the molecular formula C11H15BrN6O and a molecular weight of 327.19 g/mol. Its IUPAC name is (1E)-1-(11-bromo-4-imino-5-oxa-2,9,13,14-tetrazabicyclo[8.3.1]tetradeca-1(13),10(14),11-trien-3-ylidene)ethanamine.
| Compound Name | (1E)-1-(11-bromo-4-imino-5-oxa-2,9,13,14-tetrazabicyclo[8.3.1]tetradeca-1(13),10(14),11-trien-3-ylidene)ethanamine |
|---|---|
| PubChem CID | 137418369 |
| Molecular Formula | C11H15BrN6O |
| Molecular Weight | 327.19 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | (1E)-1-(11-bromo-4-imino-5-oxa-2,9,13,14-tetrazabicyclo[8.3.1]tetradeca-1(13),10(14),11-trien-3-ylidene)ethanamine |
| SMILES | [H]/N=C1\OCCCNc2nc(ncc2Br)N\C1=C(/C)N |
| InChI | InChI=1S/C11H15BrN6O/c1-6(13)8-9(14)19-4-2-3-15-10-7(12)5-16-11(17-8)18-10/h5,14H,2-4,13H2,1H3,(H2,15,16,17,18)/b8-6+,14-9- |
| InChIKey | FHBKVDOFIQWADL-SUGUTGAESA-N |
| XLogP | 1.65 |
| TPSA | 108.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.19 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|