C7H6F6O — CID 137418643
(3Z,5E)-1,1,1,2,2,6-hexafluorohepta-3,5-dien-3-ol (PubChem CID 137418643) has the molecular formula C7H6F6O and a molecular weight of 220.11 g/mol. Its IUPAC name is (3Z,5E)-1,1,1,2,2,6-hexafluorohepta-3,5-dien-3-ol.
| Compound Name | (3Z,5E)-1,1,1,2,2,6-hexafluorohepta-3,5-dien-3-ol |
|---|---|
| PubChem CID | 137418643 |
| Molecular Formula | C7H6F6O |
| Molecular Weight | 220.11 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | (3Z,5E)-1,1,1,2,2,6-hexafluorohepta-3,5-dien-3-ol |
| SMILES | C/C(F)=C\C=C(/O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H6F6O/c1-4(8)2-3-5(14)6(9,10)7(11,12)13/h2-3,14H,1H3/b4-2+,5-3- |
| InChIKey | NCVVIZFRDBVSAD-HZDAAVBUSA-N |
| XLogP | 3.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.11 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|