About 3-propan-2-yl-5,7-dihydro-4H-purine-2,6-dione
3-propan-2-yl-5,7-dihydro-4H-purine-2,6-dione (PubChem CID 137418846) has the molecular formula C8H12N4O2
and a molecular weight of 196.21 g/mol. Its IUPAC name is 3-propan-2-yl-5,7-dihydro-4H-purine-2,6-dione.
Molecular Properties
| Compound Name | 3-propan-2-yl-5,7-dihydro-4H-purine-2,6-dione |
| PubChem CID | 137418846 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 3-propan-2-yl-5,7-dihydro-4H-purine-2,6-dione |
| SMILES | CC(C)N1C(=O)NC(=O)C2NC=NC21 |
| InChI | InChI=1S/C8H12N4O2/c1-4(2)12-6-5(9-3-10-6)7(13)11-8(12)14/h3-6H,1-2H3,(H,9,10)(H,11,13,14) |
| InChIKey | JERCYODQCTXHBB-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-propan-2-yl-5,7-dihydro-4H-purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-yl-5,7-dihydro-4H-purine-2,6-dione?
The IUPAC name of 3-propan-2-yl-5,7-dihydro-4H-purine-2,6-dione (CID 137418846) is 3-propan-2-yl-5,7-dihydro-4H-purine-2,6-dione.
What is the SMILES notation for 3-propan-2-yl-5,7-dihydro-4H-purine-2,6-dione?
The canonical SMILES for 3-propan-2-yl-5,7-dihydro-4H-purine-2,6-dione is CC(C)N1C(=O)NC(=O)C2NC=NC21.
What is the InChIKey of 3-propan-2-yl-5,7-dihydro-4H-purine-2,6-dione?
The InChIKey is JERCYODQCTXHBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O2/c1-4(2)12-6-5(9-3-10-6)7(13)11-8(12)14/h3-6H,1-2H3,(H,9,10)(H,11,13,14).
What are the key properties of 3-propan-2-yl-5,7-dihydro-4H-purine-2,6-dione?
3-propan-2-yl-5,7-dihydro-4H-purine-2,6-dione has a molecular weight of 196.21 g/mol, XLogP of -0.73, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-yl-5,7-dihydro-4H-purine-2,6-dione is sourced from PubChem (CID 137418846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).