C48H46F8N2O4 — CID 137418946
[(E)-[[11-(2-ethylhexyl)-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]-[2-(1,1,2,2,3,3,4,4-octafluorobutoxymethyl)phenyl]methylidene]amino] acetate (PubChem CID 137418946) has the molecular formula C48H46F8N2O4 and a molecular weight of 866.89 g/mol. Its IUPAC name is [(E)-[[11-(2-ethylhexyl)-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]-[2-(1,1,2,2,3,3,4,4-octafluorobutoxymethyl)phenyl]methylidene]amino] acetate.
| Compound Name | [(E)-[[11-(2-ethylhexyl)-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]-[2-(1,1,2,2,3,3,4,4-octafluorobutoxymethyl)phenyl]methylidene]amino] acetate |
|---|---|
| PubChem CID | 137418946 |
| Molecular Formula | C48H46F8N2O4 |
| Molecular Weight | 866.89 g/mol |
| Exact Mass | 866.33 |
| IUPAC Name | [(E)-[[11-(2-ethylhexyl)-5-(2,4,6-trimethylbenzoyl)benzo[a]carbazol-8-yl]-[2-(1,1,2,2,3,3,4,4-octafluorobutoxymethyl)phenyl]methylidene]amino] acetate |
| SMILES | CCCCC(CC)Cn1c2ccc(/C(=N\OC(C)=O)c3ccccc3COC(F)(F)C(F)(F)C(F)(F)C(F)F)cc2c2cc(C(=O)c3c(C)cc(C)cc3C)c3ccccc3c21 |
| InChI | InChI=1S/C48H46F8N2O4/c1-7-9-14-31(8-2)25-58-40-20-19-32(42(57-62-30(6)59)34-16-11-10-15-33(34)26-61-48(55,56)47(53,54)46(51,52)45(49)50)23-37(40)38-24-39(35-17-12-13-18-36(35)43(38)58)44(60)41-28(4)21-27(3)22-29(41)5/h10-13,15-24,31,45H,7-9,14,25-26H2,1-6H3/b57-42+ |
| InChIKey | WPGBSLZFWQQZEV-FFZZXZHHSA-N |
| XLogP | 13.28 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.89 |
| LogP ≤ 5 | 13.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|