C22H24F3N3O4S — CID 137419188
(4aS,8aR)-4a-[5-[(3,5-difluoro-2-pyridinyl)oxy]-2-fluorophenyl]-2,2,7,7-tetramethyl-1,1-dioxo-8,8a-dihydro-5H-pyrano[4,3-b][1,4]thiazin-3-amine (PubChem CID 137419188) has the molecular formula C22H24F3N3O4S and a molecular weight of 483.51 g/mol. Its IUPAC name is (4aS,8aR)-4a-[5-[(3,5-difluoro-2-pyridinyl)oxy]-2-fluorophenyl]-2,2,7,7-tetramethyl-1,1-dioxo-8,8a-dihydro-5H-pyrano[4,3-b][1,4]thiazin-3-amine.
| Compound Name | (4aS,8aR)-4a-[5-[(3,5-difluoro-2-pyridinyl)oxy]-2-fluorophenyl]-2,2,7,7-tetramethyl-1,1-dioxo-8,8a-dihydro-5H-pyrano[4,3-b][1,4]thiazin-3-amine |
|---|---|
| PubChem CID | 137419188 |
| Molecular Formula | C22H24F3N3O4S |
| Molecular Weight | 483.51 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | (4aS,8aR)-4a-[5-[(3,5-difluoro-2-pyridinyl)oxy]-2-fluorophenyl]-2,2,7,7-tetramethyl-1,1-dioxo-8,8a-dihydro-5H-pyrano[4,3-b][1,4]thiazin-3-amine |
| SMILES | CC1(C)C[C@@H]2[C@](c3cc(Oc4ncc(F)cc4F)ccc3F)(CO1)N=C(N)C(C)(C)S2(=O)=O |
| InChI | InChI=1S/C22H24F3N3O4S/c1-20(2)9-17-22(11-31-20,28-19(26)21(3,4)33(17,29)30)14-8-13(5-6-15(14)24)32-18-16(25)7-12(23)10-27-18/h5-8,10,17H,9,11H2,1-4H3,(H2,26,28)/t17-,22-/m1/s1 |
| InChIKey | VNRVMHBCWPYCJV-VGOFRKELSA-N |
| XLogP | 3.62 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |