C29H31FN4O3S — CID 137419318
2-[4-[2-[[4-[(3R,4E,6Z)-3,8-dimethylnona-4,6,8-trien-4-yl]-5-methyl-1,3-thiazol-2-yl]amino]-2-oxoethyl]-2-fluorophenoxy]pyridine-3-carboxamide (PubChem CID 137419318) has the molecular formula C29H31FN4O3S and a molecular weight of 534.66 g/mol. Its IUPAC name is 2-[4-[2-[[4-[(3R,4E,6Z)-3,8-dimethylnona-4,6,8-trien-4-yl]-5-methyl-1,3-thiazol-2-yl]amino]-2-oxoethyl]-2-fluorophenoxy]pyridine-3-carboxamide.
| Compound Name | 2-[4-[2-[[4-[(3R,4E,6Z)-3,8-dimethylnona-4,6,8-trien-4-yl]-5-methyl-1,3-thiazol-2-yl]amino]-2-oxoethyl]-2-fluorophenoxy]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 137419318 |
| Molecular Formula | C29H31FN4O3S |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | 2-[4-[2-[[4-[(3R,4E,6Z)-3,8-dimethylnona-4,6,8-trien-4-yl]-5-methyl-1,3-thiazol-2-yl]amino]-2-oxoethyl]-2-fluorophenoxy]pyridine-3-carboxamide |
| SMILES | C=C(C)/C=C\C=C(\c1nc(NC(=O)Cc2ccc(Oc3ncccc3C(N)=O)c(F)c2)sc1C)[C@H](C)CC |
| InChI | InChI=1S/C29H31FN4O3S/c1-6-18(4)21(10-7-9-17(2)3)26-19(5)38-29(34-26)33-25(35)16-20-12-13-24(23(30)15-20)37-28-22(27(31)36)11-8-14-32-28/h7-15,18H,2,6,16H2,1,3-5H3,(H2,31,36)(H,33,34,35)/b9-7-,21-10+/t18-/m1/s1 |
| InChIKey | OICWCSUMUICSCA-WFOAZJBMSA-N |
| XLogP | 6.62 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|