About (2Z)-2-ethylidene-N,N-dimethylpyridin-1-amine
(2Z)-2-ethylidene-N,N-dimethylpyridin-1-amine (PubChem CID 137420161) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is (2Z)-2-ethylidene-N,N-dimethylpyridin-1-amine.
Molecular Properties
| Compound Name | (2Z)-2-ethylidene-N,N-dimethylpyridin-1-amine |
| PubChem CID | 137420161 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | (2Z)-2-ethylidene-N,N-dimethylpyridin-1-amine |
| SMILES | C/C=C1/C=CC=CN1N(C)C |
| InChI | InChI=1S/C9H14N2/c1-4-9-7-5-6-8-11(9)10(2)3/h4-8H,1-3H3/b9-4- |
| InChIKey | XEQBTSXABVVBGR-WTKPLQERSA-N |
| XLogP | 1.75 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2Z)-2-ethylidene-N,N-dimethylpyridin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-ethylidene-N,N-dimethylpyridin-1-amine?
The IUPAC name of (2Z)-2-ethylidene-N,N-dimethylpyridin-1-amine (CID 137420161) is (2Z)-2-ethylidene-N,N-dimethylpyridin-1-amine.
What is the SMILES notation for (2Z)-2-ethylidene-N,N-dimethylpyridin-1-amine?
The canonical SMILES for (2Z)-2-ethylidene-N,N-dimethylpyridin-1-amine is C/C=C1/C=CC=CN1N(C)C.
What is the InChIKey of (2Z)-2-ethylidene-N,N-dimethylpyridin-1-amine?
The InChIKey is XEQBTSXABVVBGR-WTKPLQERSA-N. The full InChI is InChI=1S/C9H14N2/c1-4-9-7-5-6-8-11(9)10(2)3/h4-8H,1-3H3/b9-4-.
What are the key properties of (2Z)-2-ethylidene-N,N-dimethylpyridin-1-amine?
(2Z)-2-ethylidene-N,N-dimethylpyridin-1-amine has a molecular weight of 150.22 g/mol, XLogP of 1.75, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-ethylidene-N,N-dimethylpyridin-1-amine is sourced from PubChem (CID 137420161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).