C19H20S — CID 137420223
(1E,3Z)-4-methyl-2-[(1Z)-3-methyl-1-phenylbuta-1,3-dienyl]hepta-1,3-dien-6-yne-1-thiol (PubChem CID 137420223) has the molecular formula C19H20S and a molecular weight of 280.44 g/mol. Its IUPAC name is (1E,3Z)-4-methyl-2-[(1Z)-3-methyl-1-phenylbuta-1,3-dienyl]hepta-1,3-dien-6-yne-1-thiol.
| Compound Name | (1E,3Z)-4-methyl-2-[(1Z)-3-methyl-1-phenylbuta-1,3-dienyl]hepta-1,3-dien-6-yne-1-thiol |
|---|---|
| PubChem CID | 137420223 |
| Molecular Formula | C19H20S |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (1E,3Z)-4-methyl-2-[(1Z)-3-methyl-1-phenylbuta-1,3-dienyl]hepta-1,3-dien-6-yne-1-thiol |
| SMILES | C#CC/C(C)=C\C(=C/S)\C(=C/C(=C)C)c1ccccc1 |
| InChI | InChI=1S/C19H20S/c1-5-9-16(4)13-18(14-20)19(12-15(2)3)17-10-7-6-8-11-17/h1,6-8,10-14,20H,2,9H2,3-4H3/b16-13-,18-14+,19-12- |
| InChIKey | OTPOLADYCGVOKJ-LLPVDBNKSA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|