C13H27P — CID 137420402
[(E)-2-ethyl-2,3,5,6-tetramethylhept-4-enyl]phosphane (PubChem CID 137420402) has the molecular formula C13H27P and a molecular weight of 214.33 g/mol. Its IUPAC name is [(E)-2-ethyl-2,3,5,6-tetramethylhept-4-enyl]phosphane.
| Compound Name | [(E)-2-ethyl-2,3,5,6-tetramethylhept-4-enyl]phosphane |
|---|---|
| PubChem CID | 137420402 |
| Molecular Formula | C13H27P |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | [(E)-2-ethyl-2,3,5,6-tetramethylhept-4-enyl]phosphane |
| SMILES | CCC(C)(CP)C(C)/C=C(\C)C(C)C |
| InChI | InChI=1S/C13H27P/c1-7-13(6,9-14)12(5)8-11(4)10(2)3/h8,10,12H,7,9,14H2,1-6H3/b11-8+ |
| InChIKey | YEEFVCWQMPSORK-DHZHZOJOSA-N |
| XLogP | 4.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|