C22H24O4 — CID 137420423
6-[(3Z)-cyclooct-3-en-1-yl]-6-methoxy-4,5-dihydro-3aH-phenalene-1,2,3-trione (PubChem CID 137420423) has the molecular formula C22H24O4 and a molecular weight of 352.43 g/mol. Its IUPAC name is 6-[(3Z)-cyclooct-3-en-1-yl]-6-methoxy-4,5-dihydro-3aH-phenalene-1,2,3-trione.
| Compound Name | 6-[(3Z)-cyclooct-3-en-1-yl]-6-methoxy-4,5-dihydro-3aH-phenalene-1,2,3-trione |
|---|---|
| PubChem CID | 137420423 |
| Molecular Formula | C22H24O4 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 6-[(3Z)-cyclooct-3-en-1-yl]-6-methoxy-4,5-dihydro-3aH-phenalene-1,2,3-trione |
| SMILES | COC1(C2C/C=C\CCCC2)CCC2C(=O)C(=O)C(=O)c3cccc1c32 |
| InChI | InChI=1S/C22H24O4/c1-26-22(14-8-5-3-2-4-6-9-14)13-12-16-18-15(10-7-11-17(18)22)19(23)21(25)20(16)24/h3,5,7,10-11,14,16H,2,4,6,8-9,12-13H2,1H3/b5-3- |
| InChIKey | ZQDPXNQPXKPGRY-HYXAFXHYSA-N |
| XLogP | 3.88 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|